C18H19BrN4O — CID 134031993
2-[4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 134031993) has the molecular formula C18H19BrN4O and a molecular weight of 387.28 g/mol. Its IUPAC name is 2-[4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134031993 |
| Molecular Formula | C18H19BrN4O |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | COc1ccc(Br)cc1CN1CCN(c2ncccc2C#N)CC1 |
| InChI | InChI=1S/C18H19BrN4O/c1-24-17-5-4-16(19)11-15(17)13-22-7-9-23(10-8-22)18-14(12-20)3-2-6-21-18/h2-6,11H,7-10,13H2,1H3 |
| InChIKey | GMQPXPZEMBNMTQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |