About 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile
4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile (PubChem CID 165435668) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile |
| PubChem CID | 165435668 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile |
| SMILES | Cc1ccc(C(=O)N2CC(Oc3ccnc(C#N)c3)C2)cc1C |
| InChI | InChI=1S/C18H17N3O2/c1-12-3-4-14(7-13(12)2)18(22)21-10-17(11-21)23-16-5-6-20-15(8-16)9-19/h3-8,17H,10-11H2,1-2H3 |
| InChIKey | BWINDKJCFQUBFC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile?
The IUPAC name of 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile (CID 165435668) is 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile.
What is the SMILES notation for 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile?
The canonical SMILES for 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile is Cc1ccc(C(=O)N2CC(Oc3ccnc(C#N)c3)C2)cc1C.
What is the InChIKey of 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile?
The InChIKey is BWINDKJCFQUBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-12-3-4-14(7-13(12)2)18(22)21-10-17(11-21)23-16-5-6-20-15(8-16)9-19/h3-8,17H,10-11H2,1-2H3.
What are the key properties of 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile?
4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile has a molecular weight of 307.35 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-dimethylbenzoyl)azetidin-3-yl]oxypyridine-2-carbonitrile is sourced from PubChem (CID 165435668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).