C17H22F2N2O — CID 165436163
N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide (PubChem CID 165436163) has the molecular formula C17H22F2N2O and a molecular weight of 308.37 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide.
| Compound Name | N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 165436163 |
| Molecular Formula | C17H22F2N2O |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CC(F)(F)C2)cc(C2CCNCC2)c1 |
| InChI | InChI=1S/C17H22F2N2O/c1-11-6-13(12-2-4-20-5-3-12)8-14(7-11)16(22)21-15-9-17(18,19)10-15/h6-8,12,15,20H,2-5,9-10H2,1H3,(H,21,22) |
| InChIKey | QSIDNKZYXXZHQK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |