C34H28N6O4S2 — CID 165437394
N-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-2-[[5-[2-(4-methylsulfonylphenyl)quinolin-4-yl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 165437394) has the molecular formula C34H28N6O4S2 and a molecular weight of 648.77 g/mol. Its IUPAC name is N-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-2-[[5-[2-(4-methylsulfonylphenyl)quinolin-4-yl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-2-[[5-[2-(4-methylsulfonylphenyl)quinolin-4-yl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 165437394 |
| Molecular Formula | C34H28N6O4S2 |
| Molecular Weight | 648.77 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | N-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-2-[[5-[2-(4-methylsulfonylphenyl)quinolin-4-yl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C/C(=N\O)c1ccc(NC(=O)CSc2nnc(-c3cc(-c4ccc(S(C)(=O)=O)cc4)nc4ccccc34)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H28N6O4S2/c1-22(39-42)23-12-16-25(17-13-23)35-32(41)21-45-34-38-37-33(40(34)26-8-4-3-5-9-26)29-20-31(36-30-11-7-6-10-28(29)30)24-14-18-27(19-15-24)46(2,43)44/h3-20,42H,21H2,1-2H3,(H,35,41)/b39-22+ |
| InChIKey | BQHPFZGHALBFAB-WVKHYPTHSA-N |
| XLogP | 6.48 |
| TPSA | 139.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|