C23H15Cl4N3O2 — CID 165437847
(4R)-4-(2,4-dichlorophenyl)-2-[6-[(4R)-4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole (PubChem CID 165437847) has the molecular formula C23H15Cl4N3O2 and a molecular weight of 507.20 g/mol. Its IUPAC name is (4R)-4-(2,4-dichlorophenyl)-2-[6-[(4R)-4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-(2,4-dichlorophenyl)-2-[6-[(4R)-4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 165437847 |
| Molecular Formula | C23H15Cl4N3O2 |
| Molecular Weight | 507.20 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | (4R)-4-(2,4-dichlorophenyl)-2-[6-[(4R)-4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Clc1ccc([C@@H]2COC(c3cccc(C4=N[C@H](c5ccc(Cl)cc5Cl)CO4)n3)=N2)c(Cl)c1 |
| InChI | InChI=1S/C23H15Cl4N3O2/c24-12-4-6-14(16(26)8-12)20-10-31-22(29-20)18-2-1-3-19(28-18)23-30-21(11-32-23)15-7-5-13(25)9-17(15)27/h1-9,20-21H,10-11H2/t20-,21-/m0/s1 |
| InChIKey | PWBBCWBCDCOPKX-SFTDATJTSA-N |
| XLogP | 6.73 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.20 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |