C12H18ClF2NO4 — CID 165438866
1-O-tert-butyl 4-O-(chloromethyl) 3,3-difluoropiperidine-1,4-dicarboxylate (PubChem CID 165438866) has the molecular formula C12H18ClF2NO4 and a molecular weight of 313.73 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(chloromethyl) 3,3-difluoropiperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-(chloromethyl) 3,3-difluoropiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 165438866 |
| Molecular Formula | C12H18ClF2NO4 |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-O-tert-butyl 4-O-(chloromethyl) 3,3-difluoropiperidine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)OCCl)C(F)(F)C1 |
| InChI | InChI=1S/C12H18ClF2NO4/c1-11(2,3)20-10(18)16-5-4-8(9(17)19-7-13)12(14,15)6-16/h8H,4-7H2,1-3H3 |
| InChIKey | DLNXVXQGBZJAFO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|