C11H17F2NO3 — CID 124703542
tert-butyl (4S)-3,3-difluoro-4-formylpiperidine-1-carboxylate (PubChem CID 124703542) has the molecular formula C11H17F2NO3 and a molecular weight of 249.26 g/mol. Its IUPAC name is tert-butyl (4S)-3,3-difluoro-4-formylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3,3-difluoro-4-formylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 124703542 |
| Molecular Formula | C11H17F2NO3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | tert-butyl (4S)-3,3-difluoro-4-formylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C=O)C(F)(F)C1 |
| InChI | InChI=1S/C11H17F2NO3/c1-10(2,3)17-9(16)14-5-4-8(6-15)11(12,13)7-14/h6,8H,4-5,7H2,1-3H3/t8-/m0/s1 |
| InChIKey | HRVYYOQPQLCSTP-QMMMGPOBSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|