C30H36ClN3O6 — CID 165439080
tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidin-1-yl]azetidine-1-carboxylate (PubChem CID 165439080) has the molecular formula C30H36ClN3O6 and a molecular weight of 570.09 g/mol. Its IUPAC name is tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidin-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidin-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 165439080 |
| Molecular Formula | C30H36ClN3O6 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidin-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(=O)OCCl)(N2CCC(NC(=O)OCC3c4ccccc4-c4ccccc43)C2)C1 |
| InChI | InChI=1S/C30H36ClN3O6/c1-29(2,3)40-28(37)33-17-30(18-33,14-26(35)39-19-31)34-13-12-20(15-34)32-27(36)38-16-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h4-11,20,25H,12-19H2,1-3H3,(H,32,36) |
| InChIKey | IBCJIPMNVYUCOK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|