C15H20F5NO — CID 165439977
2-(2-tert-butyl-4-methylphenoxy)-3,3,4,4,4-pentafluorobutan-1-amine (PubChem CID 165439977) has the molecular formula C15H20F5NO and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-methylphenoxy)-3,3,4,4,4-pentafluorobutan-1-amine.
| Compound Name | 2-(2-tert-butyl-4-methylphenoxy)-3,3,4,4,4-pentafluorobutan-1-amine |
|---|---|
| PubChem CID | 165439977 |
| Molecular Formula | C15H20F5NO |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-(2-tert-butyl-4-methylphenoxy)-3,3,4,4,4-pentafluorobutan-1-amine |
| SMILES | Cc1ccc(OC(CN)C(F)(F)C(F)(F)F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H20F5NO/c1-9-5-6-11(10(7-9)13(2,3)4)22-12(8-21)14(16,17)15(18,19)20/h5-7,12H,8,21H2,1-4H3 |
| InChIKey | VGVGGOBSBMAYED-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|