C12H16F3NO2 — CID 43753296
4,4,4-trifluoro-3-(2-methoxy-4-methylphenoxy)butan-1-amine (PubChem CID 43753296) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(2-methoxy-4-methylphenoxy)butan-1-amine.
| Compound Name | 4,4,4-trifluoro-3-(2-methoxy-4-methylphenoxy)butan-1-amine |
|---|---|
| PubChem CID | 43753296 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4,4,4-trifluoro-3-(2-methoxy-4-methylphenoxy)butan-1-amine |
| SMILES | COc1cc(C)ccc1OC(CCN)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO2/c1-8-3-4-9(10(7-8)17-2)18-11(5-6-16)12(13,14)15/h3-4,7,11H,5-6,16H2,1-2H3 |
| InChIKey | LYTSVLPCUOOORX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |