C12H16F3NO — CID 43753350
3-(2-ethylphenoxy)-4,4,4-trifluorobutan-1-amine (PubChem CID 43753350) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 3-(2-ethylphenoxy)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(2-ethylphenoxy)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 43753350 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-(2-ethylphenoxy)-4,4,4-trifluorobutan-1-amine |
| SMILES | CCc1ccccc1OC(CCN)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO/c1-2-9-5-3-4-6-10(9)17-11(7-8-16)12(13,14)15/h3-6,11H,2,7-8,16H2,1H3 |
| InChIKey | ABTPZQOPZCALIC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |