C12H17F3N2O — CID 61229278
3-(4-amino-1,1,1-trifluorobutan-2-yl)oxy-N,N-dimethylaniline (PubChem CID 61229278) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-(4-amino-1,1,1-trifluorobutan-2-yl)oxy-N,N-dimethylaniline.
| Compound Name | 3-(4-amino-1,1,1-trifluorobutan-2-yl)oxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 61229278 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-(4-amino-1,1,1-trifluorobutan-2-yl)oxy-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(OC(CCN)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O/c1-17(2)9-4-3-5-10(8-9)18-11(6-7-16)12(13,14)15/h3-5,8,11H,6-7,16H2,1-2H3 |
| InChIKey | CFLXIQGCNMKYMC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |