C11H12F3NO3 — CID 43753320
3-(1,3-benzodioxol-5-yloxy)-4,4,4-trifluorobutan-1-amine (PubChem CID 43753320) has the molecular formula C11H12F3NO3 and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxy)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yloxy)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 43753320 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxy)-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(Oc1ccc2c(c1)OCO2)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO3/c12-11(13,14)10(3-4-15)18-7-1-2-8-9(5-7)17-6-16-8/h1-2,5,10H,3-4,6,15H2 |
| InChIKey | LQDUZEWPRXEYJE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |