C10H8BrF3O3 — CID 64757101
5-(2-bromo-3,3,3-trifluoropropoxy)-1,3-benzodioxole (PubChem CID 64757101) has the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. Its IUPAC name is 5-(2-bromo-3,3,3-trifluoropropoxy)-1,3-benzodioxole.
| Compound Name | 5-(2-bromo-3,3,3-trifluoropropoxy)-1,3-benzodioxole |
|---|---|
| PubChem CID | 64757101 |
| Molecular Formula | C10H8BrF3O3 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 5-(2-bromo-3,3,3-trifluoropropoxy)-1,3-benzodioxole |
| SMILES | FC(F)(F)C(Br)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H8BrF3O3/c11-9(10(12,13)14)4-15-6-1-2-7-8(3-6)17-5-16-7/h1-3,9H,4-5H2 |
| InChIKey | CXQSLYWCMQUCCI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|