C13H14BrF3O — CID 64757499
6-(2-bromo-3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 64757499) has the molecular formula C13H14BrF3O and a molecular weight of 323.15 g/mol. Its IUPAC name is 6-(2-bromo-3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(2-bromo-3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 64757499 |
| Molecular Formula | C13H14BrF3O |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 6-(2-bromo-3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | FC(F)(F)C(Br)COc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H14BrF3O/c14-12(13(15,16)17)8-18-11-6-5-9-3-1-2-4-10(9)7-11/h5-7,12H,1-4,8H2 |
| InChIKey | SNVQQCMDWHQZFU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|