C10H10F5NO — CID 43753381
3-(3,4-difluorophenoxy)-4,4,4-trifluorobutan-1-amine (PubChem CID 43753381) has the molecular formula C10H10F5NO and a molecular weight of 255.19 g/mol. Its IUPAC name is 3-(3,4-difluorophenoxy)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(3,4-difluorophenoxy)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 43753381 |
| Molecular Formula | C10H10F5NO |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(3,4-difluorophenoxy)-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(Oc1ccc(F)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C10H10F5NO/c11-7-2-1-6(5-8(7)12)17-9(3-4-16)10(13,14)15/h1-2,5,9H,3-4,16H2 |
| InChIKey | LKXGWHVWZXDHMX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |