C14H20F3NO — CID 107664050
3-(4-butan-2-ylphenoxy)-4,4,4-trifluorobutan-1-amine (PubChem CID 107664050) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-(4-butan-2-ylphenoxy)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(4-butan-2-ylphenoxy)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 107664050 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-(4-butan-2-ylphenoxy)-4,4,4-trifluorobutan-1-amine |
| SMILES | CCC(C)c1ccc(OC(CCN)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3NO/c1-3-10(2)11-4-6-12(7-5-11)19-13(8-9-18)14(15,16)17/h4-7,10,13H,3,8-9,18H2,1-2H3 |
| InChIKey | WDIVZXQIZVDKSN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |