C9H10N2OS — CID 165440037
N-[(4-methyl-1,2-oxazol-3-yl)methyl]thiophen-3-amine (PubChem CID 165440037) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is N-[(4-methyl-1,2-oxazol-3-yl)methyl]thiophen-3-amine.
| Compound Name | N-[(4-methyl-1,2-oxazol-3-yl)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 165440037 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | N-[(4-methyl-1,2-oxazol-3-yl)methyl]thiophen-3-amine |
| SMILES | Cc1conc1CNc1ccsc1 |
| InChI | InChI=1S/C9H10N2OS/c1-7-5-12-11-9(7)4-10-8-2-3-13-6-8/h2-3,5-6,10H,4H2,1H3 |
| InChIKey | QGWKYSGTGBBYQU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |