C16H29ClN2O4 — CID 165440702
1-O-tert-butyl 3-O-(chloromethyl) 5-[methyl(propan-2-yl)amino]piperidine-1,3-dicarboxylate (PubChem CID 165440702) has the molecular formula C16H29ClN2O4 and a molecular weight of 348.87 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-(chloromethyl) 5-[methyl(propan-2-yl)amino]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-(chloromethyl) 5-[methyl(propan-2-yl)amino]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 165440702 |
| Molecular Formula | C16H29ClN2O4 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-O-tert-butyl 3-O-(chloromethyl) 5-[methyl(propan-2-yl)amino]piperidine-1,3-dicarboxylate |
| SMILES | CC(C)N(C)C1CC(C(=O)OCCl)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H29ClN2O4/c1-11(2)18(6)13-7-12(14(20)22-10-17)8-19(9-13)15(21)23-16(3,4)5/h11-13H,7-10H2,1-6H3 |
| InChIKey | KOYJEYJPVMWNCN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|