C15H29N — CID 165449949
3-(3,3,5,5-tetramethylcyclohexyl)piperidine (PubChem CID 165449949) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 3-(3,3,5,5-tetramethylcyclohexyl)piperidine.
| Compound Name | 3-(3,3,5,5-tetramethylcyclohexyl)piperidine |
|---|---|
| PubChem CID | 165449949 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 3-(3,3,5,5-tetramethylcyclohexyl)piperidine |
| SMILES | CC1(C)CC(C2CCCNC2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H29N/c1-14(2)8-13(9-15(3,4)11-14)12-6-5-7-16-10-12/h12-13,16H,5-11H2,1-4H3 |
| InChIKey | VQYSAQXHRVGVCM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |