C13H19NaO4S — CID 165454162
sodium 4-(2-ethoxyethoxy)-3-propan-2-ylbenzenesulfinate (PubChem CID 165454162) has the molecular formula C13H19NaO4S and a molecular weight of 294.35 g/mol. Its IUPAC name is sodium 4-(2-ethoxyethoxy)-3-propan-2-ylbenzenesulfinate.
| Compound Name | sodium 4-(2-ethoxyethoxy)-3-propan-2-ylbenzenesulfinate |
|---|---|
| PubChem CID | 165454162 |
| Molecular Formula | C13H19NaO4S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | sodium 4-(2-ethoxyethoxy)-3-propan-2-ylbenzenesulfinate |
| SMILES | CCOCCOc1ccc(S(=O)[O-])cc1C(C)C.[Na+] |
| InChI | InChI=1S/C13H20O4S.Na/c1-4-16-7-8-17-13-6-5-11(18(14)15)9-12(13)10(2)3;/h5-6,9-10H,4,7-8H2,1-3H3,(H,14,15);/q;+1/p-1 |
| InChIKey | VKLKGAQYYDJLQU-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|