C9H19NO4S — CID 165454493
N-(3-ethylsulfonyl-2-hydroxypropyl)-2-methylpropanamide (PubChem CID 165454493) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is N-(3-ethylsulfonyl-2-hydroxypropyl)-2-methylpropanamide.
| Compound Name | N-(3-ethylsulfonyl-2-hydroxypropyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 165454493 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(3-ethylsulfonyl-2-hydroxypropyl)-2-methylpropanamide |
| SMILES | CCS(=O)(=O)CC(O)CNC(=O)C(C)C |
| InChI | InChI=1S/C9H19NO4S/c1-4-15(13,14)6-8(11)5-10-9(12)7(2)3/h7-8,11H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | PGTAZBSOGDEMFO-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |