C11H8FNO2S — CID 165455699
2-fluoro-4-(3-methoxy-1,2-thiazol-4-yl)benzaldehyde (PubChem CID 165455699) has the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-fluoro-4-(3-methoxy-1,2-thiazol-4-yl)benzaldehyde.
| Compound Name | 2-fluoro-4-(3-methoxy-1,2-thiazol-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 165455699 |
| Molecular Formula | C11H8FNO2S |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-fluoro-4-(3-methoxy-1,2-thiazol-4-yl)benzaldehyde |
| SMILES | COc1nscc1-c1ccc(C=O)c(F)c1 |
| InChI | InChI=1S/C11H8FNO2S/c1-15-11-9(6-16-13-11)7-2-3-8(5-14)10(12)4-7/h2-6H,1H3 |
| InChIKey | LDNALEGGDXXYOJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|