C8H14N4O — CID 165457739
2-methoxy-1-(3-prop-2-enyltriazol-4-yl)ethanamine (PubChem CID 165457739) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-methoxy-1-(3-prop-2-enyltriazol-4-yl)ethanamine.
| Compound Name | 2-methoxy-1-(3-prop-2-enyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 165457739 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-methoxy-1-(3-prop-2-enyltriazol-4-yl)ethanamine |
| SMILES | C=CCn1nncc1C(N)COC |
| InChI | InChI=1S/C8H14N4O/c1-3-4-12-8(5-10-11-12)7(9)6-13-2/h3,5,7H,1,4,6,9H2,2H3 |
| InChIKey | OFIREEOCHYNDLX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|