C7H10BrF2N3O — CID 165459851
5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole (PubChem CID 165459851) has the molecular formula C7H10BrF2N3O and a molecular weight of 270.08 g/mol. Its IUPAC name is 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole.
| Compound Name | 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole |
|---|---|
| PubChem CID | 165459851 |
| Molecular Formula | C7H10BrF2N3O |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole |
| SMILES | COCC(Br)c1cnnn1CC(F)F |
| InChI | InChI=1S/C7H10BrF2N3O/c1-14-4-5(8)6-2-11-12-13(6)3-7(9)10/h2,5,7H,3-4H2,1H3 |
| InChIKey | QTNWYZWPHWRRLU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|