About 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole
5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole (PubChem CID 165459851) has the molecular formula C7H10BrF2N3O
and a molecular weight of 270.08 g/mol. Its IUPAC name is 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole.
Molecular Properties
| Compound Name | 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole |
| PubChem CID | 165459851 |
| Molecular Formula | C7H10BrF2N3O |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole |
| SMILES | COCC(Br)c1cnnn1CC(F)F |
| InChI | InChI=1S/C7H10BrF2N3O/c1-14-4-5(8)6-2-11-12-13(6)3-7(9)10/h2,5,7H,3-4H2,1H3 |
| InChIKey | QTNWYZWPHWRRLU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole?
The IUPAC name of 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole (CID 165459851) is 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole.
What is the SMILES notation for 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole?
The canonical SMILES for 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole is COCC(Br)c1cnnn1CC(F)F.
What is the InChIKey of 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole?
The InChIKey is QTNWYZWPHWRRLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrF2N3O/c1-14-4-5(8)6-2-11-12-13(6)3-7(9)10/h2,5,7H,3-4H2,1H3.
What are the key properties of 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole?
5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole has a molecular weight of 270.08 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-bromo-2-methoxyethyl)-1-(2,2-difluoroethyl)triazole is sourced from PubChem (CID 165459851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).