C9H8BrFN2O3S — CID 165459709
6-bromo-1,3-dimethyl-2-oxobenzimidazole-5-sulfonyl fluoride (PubChem CID 165459709) has the molecular formula C9H8BrFN2O3S and a molecular weight of 323.14 g/mol. Its IUPAC name is 6-bromo-1,3-dimethyl-2-oxobenzimidazole-5-sulfonyl fluoride.
| Compound Name | 6-bromo-1,3-dimethyl-2-oxobenzimidazole-5-sulfonyl fluoride |
|---|---|
| PubChem CID | 165459709 |
| Molecular Formula | C9H8BrFN2O3S |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | 6-bromo-1,3-dimethyl-2-oxobenzimidazole-5-sulfonyl fluoride |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)F)c(Br)cc21 |
| InChI | InChI=1S/C9H8BrFN2O3S/c1-12-6-3-5(10)8(17(11,15)16)4-7(6)13(2)9(12)14/h3-4H,1-2H3 |
| InChIKey | REPLYCXATNZFTD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |