C22H19N3O3S — CID 16546204
4-(2,5-dioxopyrrolidin-1-yl)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]benzamide (PubChem CID 16546204) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 16546204 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]benzamide |
| SMILES | Cc1ccc(Cn2ccs/c2=N\C(=O)c2ccc(N3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-15-2-4-16(5-3-15)14-24-12-13-29-22(24)23-21(28)17-6-8-18(9-7-17)25-19(26)10-11-20(25)27/h2-9,12-13H,10-11,14H2,1H3/b23-22- |
| InChIKey | KPHDMEKBSAMZMH-FCQUAONHSA-N |
| XLogP | 3.30 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|