C15H15N3O3S — CID 51950675
cis-(1S,2R)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-2-nitrocyclopropane-1-carboxamide (PubChem CID 51950675) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is cis-(1S,2R)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51950675 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | cis-(1S,2R)-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-2-nitrocyclopropane-1-carboxamide |
| SMILES | Cc1ccc(Cn2ccs/c2=N\C(=O)[C@H]2C[C@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15N3O3S/c1-10-2-4-11(5-3-10)9-17-6-7-22-15(17)16-14(19)12-8-13(12)18(20)21/h2-7,12-13H,8-9H2,1H3/b16-15-/t12-,13+/m0/s1 |
| InChIKey | XSTUVDAWWKNVCV-UBQVSUSGSA-N |
| XLogP | 2.00 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|