C14H22F2N2 — CID 165462183
N-benzyl-2,2-difluoro-N-methyl-N'-propylpropane-1,3-diamine (PubChem CID 165462183) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is N-benzyl-2,2-difluoro-N-methyl-N'-propylpropane-1,3-diamine.
| Compound Name | N-benzyl-2,2-difluoro-N-methyl-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 165462183 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-benzyl-2,2-difluoro-N-methyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCNCC(F)(F)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H22F2N2/c1-3-9-17-11-14(15,16)12-18(2)10-13-7-5-4-6-8-13/h4-8,17H,3,9-12H2,1-2H3 |
| InChIKey | AJXMIFWXQZBRTK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|