C17H29BrN2 — CID 63494839
N-[(3-bromophenyl)methyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine (PubChem CID 63494839) has the molecular formula C17H29BrN2 and a molecular weight of 341.34 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine.
| Compound Name | N-[(3-bromophenyl)methyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63494839 |
| Molecular Formula | C17H29BrN2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-ethyl-N,2-dimethyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCNCC(C)(CC)CN(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C17H29BrN2/c1-5-10-19-13-17(3,6-2)14-20(4)12-15-8-7-9-16(18)11-15/h7-9,11,19H,5-6,10,12-14H2,1-4H3 |
| InChIKey | SNTVYZVWTDISSW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|