About tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate
tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate (PubChem CID 165462529) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate.
Molecular Properties
| Compound Name | tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate |
| PubChem CID | 165462529 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate |
| SMILES | Cc1cc(C#CC(=O)OC(C)(C)C)c(C)s1 |
| InChI | InChI=1S/C13H16O2S/c1-9-8-11(10(2)16-9)6-7-12(14)15-13(3,4)5/h8H,1-5H3 |
| InChIKey | BWWTUFSOSAOPMI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate?
The IUPAC name of tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate (CID 165462529) is tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate.
What is the SMILES notation for tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate?
The canonical SMILES for tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate is Cc1cc(C#CC(=O)OC(C)(C)C)c(C)s1.
What is the InChIKey of tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate?
The InChIKey is BWWTUFSOSAOPMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2S/c1-9-8-11(10(2)16-9)6-7-12(14)15-13(3,4)5/h8H,1-5H3.
What are the key properties of tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate?
tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate has a molecular weight of 236.34 g/mol, XLogP of 3.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(2,5-dimethylthiophen-3-yl)prop-2-ynoate is sourced from PubChem (CID 165462529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).