About ditert-butyl but-2-ynedioate
ditert-butyl but-2-ynedioate (PubChem CID 545317) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is ditert-butyl but-2-ynedioate.
Molecular Properties
| Compound Name | ditert-butyl but-2-ynedioate |
| PubChem CID | 545317 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | ditert-butyl but-2-ynedioate |
| SMILES | CC(C)(C)OC(=O)C#CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H18O4/c1-11(2,3)15-9(13)7-8-10(14)16-12(4,5)6/h1-6H3 |
| InChIKey | FBCRUXRGQFLOMC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl but-2-ynedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl but-2-ynedioate?
The IUPAC name of ditert-butyl but-2-ynedioate (CID 545317) is ditert-butyl but-2-ynedioate.
What is the SMILES notation for ditert-butyl but-2-ynedioate?
The canonical SMILES for ditert-butyl but-2-ynedioate is CC(C)(C)OC(=O)C#CC(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl but-2-ynedioate?
The InChIKey is FBCRUXRGQFLOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-11(2,3)15-9(13)7-8-10(14)16-12(4,5)6/h1-6H3.
What are the key properties of ditert-butyl but-2-ynedioate?
ditert-butyl but-2-ynedioate has a molecular weight of 226.27 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl but-2-ynedioate is sourced from PubChem (CID 545317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).