4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride

C8H8ClN3O3S — CID 165462950

IUPAC4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride
SMILESCCn1c(-c2ccoc2)nnc1S(=O)(=O)Cl
InChIInChI=1S/C8H8ClN3O3S/c1-2-12-7(6-3-4-15-5-6)10-11-8(12)16(9,13)14/h3-5H,2H2,1H3
InChIKeyCMVBXMYPQAGJLX-UHFFFAOYSA-N
MW261.69 g/mol
LogP1.49
Rot. Bonds3

About 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride

4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 165462950) has the molecular formula C8H8ClN3O3S and a molecular weight of 261.69 g/mol. Its IUPAC name is 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride.

Molecular Properties

Compound Name4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride
PubChem CID165462950
Molecular FormulaC8H8ClN3O3S
Molecular Weight261.69 g/mol
Exact Mass261.00
IUPAC Name4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride
SMILESCCn1c(-c2ccoc2)nnc1S(=O)(=O)Cl
InChIInChI=1S/C8H8ClN3O3S/c1-2-12-7(6-3-4-15-5-6)10-11-8(12)16(9,13)14/h3-5H,2H2,1H3
InChIKeyCMVBXMYPQAGJLX-UHFFFAOYSA-N
XLogP1.49
TPSA77.99 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.69
LogP ≤ 51.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride?
The IUPAC name of 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride (CID 165462950) is 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride.
What is the SMILES notation for 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride?
The canonical SMILES for 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride is CCn1c(-c2ccoc2)nnc1S(=O)(=O)Cl.
What is the InChIKey of 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride?
The InChIKey is CMVBXMYPQAGJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O3S/c1-2-12-7(6-3-4-15-5-6)10-11-8(12)16(9,13)14/h3-5H,2H2,1H3.
What are the key properties of 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride?
4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride has a molecular weight of 261.69 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride is sourced from PubChem (CID 165462950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).