C8H8ClN3O3S — CID 165462950
4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 165462950) has the molecular formula C8H8ClN3O3S and a molecular weight of 261.69 g/mol. Its IUPAC name is 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 165462950 |
| Molecular Formula | C8H8ClN3O3S |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4-ethyl-5-(furan-3-yl)-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CCn1c(-c2ccoc2)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H8ClN3O3S/c1-2-12-7(6-3-4-15-5-6)10-11-8(12)16(9,13)14/h3-5H,2H2,1H3 |
| InChIKey | CMVBXMYPQAGJLX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |