C22H17ClF3N3O4 — CID 16546519
N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 16546519) has the molecular formula C22H17ClF3N3O4 and a molecular weight of 479.84 g/mol. Its IUPAC name is N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 16546519 |
| Molecular Formula | C22H17ClF3N3O4 |
| Molecular Weight | 479.84 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)N(C)CC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2C1=O |
| InChI | InChI=1S/C22H17ClF3N3O4/c1-3-8-29-20(32)14-6-4-12(9-15(14)21(29)33)19(31)28(2)11-18(30)27-13-5-7-17(23)16(10-13)22(24,25)26/h3-7,9-10H,1,8,11H2,2H3,(H,27,30) |
| InChIKey | CONPFZFFFNDLPK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|