C13H19NO4 — CID 165465733
tert-butyl N-[(2R)-1-(5-methylfuran-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 165465733) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(5-methylfuran-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(5-methylfuran-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 165465733 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | tert-butyl N-[(2R)-1-(5-methylfuran-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1cc(C(=O)[C@@H](C)NC(=O)OC(C)(C)C)co1 |
| InChI | InChI=1S/C13H19NO4/c1-8-6-10(7-17-8)11(15)9(2)14-12(16)18-13(3,4)5/h6-7,9H,1-5H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | SMNIZIAATUSVEE-SECBINFHSA-N |
| XLogP | 2.68 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |