C10H20N2O3S — CID 165465950
(1-butanoyl-4-methylpyrrolidin-3-yl)methanesulfonamide (PubChem CID 165465950) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is (1-butanoyl-4-methylpyrrolidin-3-yl)methanesulfonamide.
| Compound Name | (1-butanoyl-4-methylpyrrolidin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 165465950 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (1-butanoyl-4-methylpyrrolidin-3-yl)methanesulfonamide |
| SMILES | CCCC(=O)N1CC(C)C(CS(N)(=O)=O)C1 |
| InChI | InChI=1S/C10H20N2O3S/c1-3-4-10(13)12-5-8(2)9(6-12)7-16(11,14)15/h8-9H,3-7H2,1-2H3,(H2,11,14,15) |
| InChIKey | UNUJLYAMZWLUOD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |