C8H16F2N2O2 — CID 165467492
2,2-difluoro-3-(3-methylbutan-2-yloxy)propanehydrazide (PubChem CID 165467492) has the molecular formula C8H16F2N2O2 and a molecular weight of 210.22 g/mol. Its IUPAC name is 2,2-difluoro-3-(3-methylbutan-2-yloxy)propanehydrazide.
| Compound Name | 2,2-difluoro-3-(3-methylbutan-2-yloxy)propanehydrazide |
|---|---|
| PubChem CID | 165467492 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2,2-difluoro-3-(3-methylbutan-2-yloxy)propanehydrazide |
| SMILES | CC(C)C(C)OCC(F)(F)C(=O)NN |
| InChI | InChI=1S/C8H16F2N2O2/c1-5(2)6(3)14-4-8(9,10)7(13)12-11/h5-6H,4,11H2,1-3H3,(H,12,13) |
| InChIKey | NSHPXYATKDIZLI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|