C21H16ClN3O3S — CID 16546945
N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 16546945) has the molecular formula C21H16ClN3O3S and a molecular weight of 425.90 g/mol. Its IUPAC name is N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 16546945 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)N(CC)c3nc4cc(Cl)ccc4s3)cc2C1=O |
| InChI | InChI=1S/C21H16ClN3O3S/c1-3-9-25-19(27)14-7-5-12(10-15(14)20(25)28)18(26)24(4-2)21-23-16-11-13(22)6-8-17(16)29-21/h3,5-8,10-11H,1,4,9H2,2H3 |
| InChIKey | REJNXOQORKCUBO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|