C18H17ClN2O3S — CID 18081188
N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-3,4-dimethoxybenzamide (PubChem CID 18081188) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-3,4-dimethoxybenzamide.
| Compound Name | N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 18081188 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-(5-chloro-1,3-benzothiazol-2-yl)-N-ethyl-3,4-dimethoxybenzamide |
| SMILES | CCN(C(=O)c1ccc(OC)c(OC)c1)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C18H17ClN2O3S/c1-4-21(18-20-13-10-12(19)6-8-16(13)25-18)17(22)11-5-7-14(23-2)15(9-11)24-3/h5-10H,4H2,1-3H3 |
| InChIKey | HYEGZFQONNOWGE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |