C13H23NO4 — CID 165471468
tert-butyl N-[1-(2-ethoxyacetyl)cyclopropyl]-N-methylcarbamate (PubChem CID 165471468) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl N-[1-(2-ethoxyacetyl)cyclopropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(2-ethoxyacetyl)cyclopropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 165471468 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl N-[1-(2-ethoxyacetyl)cyclopropyl]-N-methylcarbamate |
| SMILES | CCOCC(=O)C1(N(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H23NO4/c1-6-17-9-10(15)13(7-8-13)14(5)11(16)18-12(2,3)4/h6-9H2,1-5H3 |
| InChIKey | GYZYYFGAWHEGJY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |