C11H19F2NO3 — CID 142576914
tert-butyl N-[1-(difluoromethoxymethyl)cyclopropyl]-N-methylcarbamate (PubChem CID 142576914) has the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. Its IUPAC name is tert-butyl N-[1-(difluoromethoxymethyl)cyclopropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(difluoromethoxymethyl)cyclopropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 142576914 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | tert-butyl N-[1-(difluoromethoxymethyl)cyclopropyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1(COC(F)F)CC1 |
| InChI | InChI=1S/C11H19F2NO3/c1-10(2,3)17-9(15)14(4)11(5-6-11)7-16-8(12)13/h8H,5-7H2,1-4H3 |
| InChIKey | INNSUAGVZVQTKR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |