C7H11F2N3 — CID 165472720
1-(4,4-difluorobutyl)pyrazol-4-amine (PubChem CID 165472720) has the molecular formula C7H11F2N3 and a molecular weight of 175.18 g/mol. Its IUPAC name is 1-(4,4-difluorobutyl)pyrazol-4-amine.
| Compound Name | 1-(4,4-difluorobutyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 165472720 |
| Molecular Formula | C7H11F2N3 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 1-(4,4-difluorobutyl)pyrazol-4-amine |
| SMILES | Nc1cnn(CCCC(F)F)c1 |
| InChI | InChI=1S/C7H11F2N3/c8-7(9)2-1-3-12-5-6(10)4-11-12/h4-5,7H,1-3,10H2 |
| InChIKey | MDVQFPLBEZPOJG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |