C11H19N3 — CID 165481618
1-[3-(2,2-dimethylcyclopropyl)propyl]pyrazol-4-amine (PubChem CID 165481618) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylcyclopropyl)propyl]pyrazol-4-amine.
| Compound Name | 1-[3-(2,2-dimethylcyclopropyl)propyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 165481618 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-[3-(2,2-dimethylcyclopropyl)propyl]pyrazol-4-amine |
| SMILES | CC1(C)CC1CCCn1cc(N)cn1 |
| InChI | InChI=1S/C11H19N3/c1-11(2)6-9(11)4-3-5-14-8-10(12)7-13-14/h7-9H,3-6,12H2,1-2H3 |
| InChIKey | WMQNIPRCDARSFU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |