C10H14F2O2 — CID 165474309
1-cyclopropyl-2-ethyl-4,4-difluoropentane-1,3-dione (PubChem CID 165474309) has the molecular formula C10H14F2O2 and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-cyclopropyl-2-ethyl-4,4-difluoropentane-1,3-dione.
| Compound Name | 1-cyclopropyl-2-ethyl-4,4-difluoropentane-1,3-dione |
|---|---|
| PubChem CID | 165474309 |
| Molecular Formula | C10H14F2O2 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-cyclopropyl-2-ethyl-4,4-difluoropentane-1,3-dione |
| SMILES | CCC(C(=O)C1CC1)C(=O)C(C)(F)F |
| InChI | InChI=1S/C10H14F2O2/c1-3-7(8(13)6-4-5-6)9(14)10(2,11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | AWCZWSVNCLZMKR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|