C10H13F3O2 — CID 165474183
1-cyclobutyl-2-ethyl-4,4,4-trifluorobutane-1,3-dione (PubChem CID 165474183) has the molecular formula C10H13F3O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 1-cyclobutyl-2-ethyl-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-cyclobutyl-2-ethyl-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 165474183 |
| Molecular Formula | C10H13F3O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-cyclobutyl-2-ethyl-4,4,4-trifluorobutane-1,3-dione |
| SMILES | CCC(C(=O)C1CCC1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O2/c1-2-7(9(15)10(11,12)13)8(14)6-4-3-5-6/h6-7H,2-5H2,1H3 |
| InChIKey | NJZQOFNEHPYGME-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|