C11H13F3O4 — CID 165483335
methyl 2-(cyclobutanecarbonyl)-5,5,5-trifluoro-4-oxopentanoate (PubChem CID 165483335) has the molecular formula C11H13F3O4 and a molecular weight of 266.21 g/mol. Its IUPAC name is methyl 2-(cyclobutanecarbonyl)-5,5,5-trifluoro-4-oxopentanoate.
| Compound Name | methyl 2-(cyclobutanecarbonyl)-5,5,5-trifluoro-4-oxopentanoate |
|---|---|
| PubChem CID | 165483335 |
| Molecular Formula | C11H13F3O4 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl 2-(cyclobutanecarbonyl)-5,5,5-trifluoro-4-oxopentanoate |
| SMILES | COC(=O)C(CC(=O)C(F)(F)F)C(=O)C1CCC1 |
| InChI | InChI=1S/C11H13F3O4/c1-18-10(17)7(5-8(15)11(12,13)14)9(16)6-3-2-4-6/h6-7H,2-5H2,1H3 |
| InChIKey | JKZMLESBCYOMBZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|