C10H15N3O2 — CID 165474630
4-methyl-1-(1-methyltriazol-4-yl)hexane-1,3-dione (PubChem CID 165474630) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-methyl-1-(1-methyltriazol-4-yl)hexane-1,3-dione.
| Compound Name | 4-methyl-1-(1-methyltriazol-4-yl)hexane-1,3-dione |
|---|---|
| PubChem CID | 165474630 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-methyl-1-(1-methyltriazol-4-yl)hexane-1,3-dione |
| SMILES | CCC(C)C(=O)CC(=O)c1cn(C)nn1 |
| InChI | InChI=1S/C10H15N3O2/c1-4-7(2)9(14)5-10(15)8-6-13(3)12-11-8/h6-7H,4-5H2,1-3H3 |
| InChIKey | AGGYWOYWZGVMRE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|