C14H26N2O3 — CID 165474931
tert-butyl 4-amino-4-(oxolan-2-yl)piperidine-1-carboxylate (PubChem CID 165474931) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl 4-amino-4-(oxolan-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-amino-4-(oxolan-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 165474931 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | tert-butyl 4-amino-4-(oxolan-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)(C2CCCO2)CC1 |
| InChI | InChI=1S/C14H26N2O3/c1-13(2,3)19-12(17)16-8-6-14(15,7-9-16)11-5-4-10-18-11/h11H,4-10,15H2,1-3H3 |
| InChIKey | YTHDCHBLGRGIRZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |