C10H17N3O2 — CID 165475243
3-(4-ethylpyrazol-1-yl)-2-methyl-2-(methylamino)propanoic acid (PubChem CID 165475243) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(4-ethylpyrazol-1-yl)-2-methyl-2-(methylamino)propanoic acid.
| Compound Name | 3-(4-ethylpyrazol-1-yl)-2-methyl-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 165475243 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-(4-ethylpyrazol-1-yl)-2-methyl-2-(methylamino)propanoic acid |
| SMILES | CCc1cnn(CC(C)(NC)C(=O)O)c1 |
| InChI | InChI=1S/C10H17N3O2/c1-4-8-5-12-13(6-8)7-10(2,11-3)9(14)15/h5-6,11H,4,7H2,1-3H3,(H,14,15) |
| InChIKey | WFPSUZPVCNCCRZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |