C14H18IN3O — CID 165475686
N-[[3-(4-iodopyrazol-1-yl)phenyl]methyl]-3-methoxypropan-1-amine (PubChem CID 165475686) has the molecular formula C14H18IN3O and a molecular weight of 371.22 g/mol. Its IUPAC name is N-[[3-(4-iodopyrazol-1-yl)phenyl]methyl]-3-methoxypropan-1-amine.
| Compound Name | N-[[3-(4-iodopyrazol-1-yl)phenyl]methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 165475686 |
| Molecular Formula | C14H18IN3O |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-[[3-(4-iodopyrazol-1-yl)phenyl]methyl]-3-methoxypropan-1-amine |
| SMILES | COCCCNCc1cccc(-n2cc(I)cn2)c1 |
| InChI | InChI=1S/C14H18IN3O/c1-19-7-3-6-16-9-12-4-2-5-14(8-12)18-11-13(15)10-17-18/h2,4-5,8,10-11,16H,3,6-7,9H2,1H3 |
| InChIKey | CWAKTUXGCORZFL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|